Halazepam
 |
 |
| Systematic (IUPAC) name |
| 7-chloro- 5-phenyl- 1-(2,2,2-trifluoroethyl) -1,3-dihydro- 2H-1,4-benzodiazepin- 2-one |
| Clinical data |
| AHFS/Drugs.com |
Micromedex Detailed Consumer Information |
| MedlinePlus |
a684001 |
| Pregnancy cat. |
? |
| Legal status |
Schedule IV (US) |
| Routes |
Oral |
| Pharmacokinetic data |
| Bioavailability |
? |
| Metabolism |
Hepatic |
| Half-life |
? |
| Excretion |
Renal |
| Identifiers |
| CAS number |
23092-17-3  Y |
| ATC code |
N05BA13 |
| PubChem |
CID 31640 |
| DrugBank |
DB00801 |
| ChemSpider |
29343 Y |
| UNII |
320YC168LF Y |
| KEGG |
D00338 Y |
| ChEMBL |
CHEMBL970 Y |
| Synonyms |
9-chloro- 6-phenyl- 2-(2,2,2-trifluoroethyl)- 2,5-diazabicyclo[5.4.0] undeca- 5,8,10,12-tetraen -3-one |
| Chemical data |
| Formula |
C17H12ClF3N2O |
| Mol. mass |
352.7 |
- FC(F)(CN1C(CN=C(C2=CC=CC=C2)C3=C1C=CC(Cl)=C3)=O)F
|
-
InChI=1S/C17H12ClF3N2O/c18-12-6-7-14-13(8-12)16(11-4-2-1-3-5-11)22-9-15(24)23(14)10-17(19,20)21/h1-8H,9-10H2 Y
Key:WYCLKVQLVUQKNZ-UHFFFAOYSA-N Y
|
 Y (what is this?) (verify)
|
Halazepam[1] is a benzodiazepine derivative and is marketed under the brand names Alapryl and Pacinone It is no longer marketed in the United States. It had been marketed under the name Paxipam, but was withdrawn by its manufacturer, Schering Plough, for poor sales. It possesses anxiolytic, anticonvulsant, sedative and skeletal muscle relaxant properties. It is a trifluoroethyl derivative of nordazepam.[2] While its structure may be similar to chlordiazepoxide and diazepam, it has both less toxicity and less tendency to cause paradoxical hostility and aggression than either of them.[3] Halazepam has active benzodiazepine metabolites.[4]
Indications [edit]
Halazepam is indicated for the treatment of anxiety.[5]
See also [edit]
References [edit]
- ^ FR Patent 1518382
- ^ Greenblatt, D. J.; A. Locniskar and R. I. Shader (June 12, 1982). "Halazepam, another precursor of desmethyldiazepam". Lancet 1 (8285): 1358–9. PMID 6123659.
- ^ Fann, W. E.; W. M. Pitts and J. C. Wheless (Mar-Apr 1982). "Pharmacology, efficacy, and adverse effects of halazepam, a new benzodiazepine". Pharmacotherapy 2 (2): 72–9. PMID 6152591.
- ^ Jochemsen R, Breimer DD (1984). "Pharmacokinetics of benzodiazepines: metabolic pathways and plasma level profiles". Curr Med Res Opin. 8. Suppl 4: 60–79. PMID 6144464.
- ^ Lozano, Lozano, Lozano, et al. (1990). "[Open clinical study of the efficacy and safety of Halazepam in anxiety disorders]". Actas Luso Esp Neurol Psiquiatr Cienc Afines (in Spanish; Castilian) 18 (4): 205–11. PMID 1981637.
External links [edit]
|
|
|
| 1,4-Benzodiazepines |
|
|
| 1,5-Benzodiazepines |
|
|
| 2,3-Benzodiazepines * |
|
|
| Triazolobenzodiazepines |
|
|
| Imidazobenzodiazepines |
|
|
| Oxazolobenzodiazepines |
|
|
| Thienodiazepines |
|
|
| Pyridodiazepines |
|
|
| Pyrazolodiazepines |
|
|
| Pyrrolodiazepines |
|
|
| Tetrahydroisoquinobenzodiazepines |
|
|
| Benzodiazepine prodrugs |
|
|
|
|
|
(what is this?) (verify)
